C14H14Cl2N2O6 — CID 12897311
ethyl 2-[2,4-dichloro-5-[(2-ethoxy-2-oxoacetyl)amino]anilino]-2-oxoacetate (PubChem CID 12897311) has the molecular formula C14H14Cl2N2O6 and a molecular weight of 377.18 g/mol. Its IUPAC name is ethyl 2-[2,4-dichloro-5-[(2-ethoxy-2-oxoacetyl)amino]anilino]-2-oxoacetate.
| Compound Name | ethyl 2-[2,4-dichloro-5-[(2-ethoxy-2-oxoacetyl)amino]anilino]-2-oxoacetate |
|---|---|
| PubChem CID | 12897311 |
| Molecular Formula | C14H14Cl2N2O6 |
| Molecular Weight | 377.18 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | ethyl 2-[2,4-dichloro-5-[(2-ethoxy-2-oxoacetyl)amino]anilino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1cc(NC(=O)C(=O)OCC)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H14Cl2N2O6/c1-3-23-13(21)11(19)17-9-6-10(8(16)5-7(9)15)18-12(20)14(22)24-4-2/h5-6H,3-4H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | JFFLSKQEUQKRIR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|