C10H8ClF2NO3 — CID 83087259
ethyl 2-(2-chloro-4,6-difluoroanilino)-2-oxoacetate (PubChem CID 83087259) has the molecular formula C10H8ClF2NO3 and a molecular weight of 263.63 g/mol. Its IUPAC name is ethyl 2-(2-chloro-4,6-difluoroanilino)-2-oxoacetate.
| Compound Name | ethyl 2-(2-chloro-4,6-difluoroanilino)-2-oxoacetate |
|---|---|
| PubChem CID | 83087259 |
| Molecular Formula | C10H8ClF2NO3 |
| Molecular Weight | 263.63 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | ethyl 2-(2-chloro-4,6-difluoroanilino)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C10H8ClF2NO3/c1-2-17-10(16)9(15)14-8-6(11)3-5(12)4-7(8)13/h3-4H,2H2,1H3,(H,14,15) |
| InChIKey | WHJCVRKDYLDIIU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.63 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|