C9H6F3NO3 — CID 112617383
methyl 2-oxo-2-(2,4,6-trifluoroanilino)acetate (PubChem CID 112617383) has the molecular formula C9H6F3NO3 and a molecular weight of 233.14 g/mol. Its IUPAC name is methyl 2-oxo-2-(2,4,6-trifluoroanilino)acetate.
| Compound Name | methyl 2-oxo-2-(2,4,6-trifluoroanilino)acetate |
|---|---|
| PubChem CID | 112617383 |
| Molecular Formula | C9H6F3NO3 |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | methyl 2-oxo-2-(2,4,6-trifluoroanilino)acetate |
| SMILES | COC(=O)C(=O)Nc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C9H6F3NO3/c1-16-9(15)8(14)13-7-5(11)2-4(10)3-6(7)12/h2-3H,1H3,(H,13,14) |
| InChIKey | DMFVFJLJDHANCM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|