C10H8Cl2FNO3 — CID 83078471
ethyl 2-(2,6-dichloro-4-fluoroanilino)-2-oxoacetate (PubChem CID 83078471) has the molecular formula C10H8Cl2FNO3 and a molecular weight of 280.08 g/mol. Its IUPAC name is ethyl 2-(2,6-dichloro-4-fluoroanilino)-2-oxoacetate.
| Compound Name | ethyl 2-(2,6-dichloro-4-fluoroanilino)-2-oxoacetate |
|---|---|
| PubChem CID | 83078471 |
| Molecular Formula | C10H8Cl2FNO3 |
| Molecular Weight | 280.08 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | ethyl 2-(2,6-dichloro-4-fluoroanilino)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C10H8Cl2FNO3/c1-2-17-10(16)9(15)14-8-6(11)3-5(13)4-7(8)12/h3-4H,2H2,1H3,(H,14,15) |
| InChIKey | NNVBVMOZYVDRKT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.08 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|