C15H17ClN2O6 — CID 12897321
ethyl 2-[2-chloro-3-[(2-ethoxy-2-oxoacetyl)amino]-5-methylanilino]-2-oxoacetate (PubChem CID 12897321) has the molecular formula C15H17ClN2O6 and a molecular weight of 356.76 g/mol. Its IUPAC name is ethyl 2-[2-chloro-3-[(2-ethoxy-2-oxoacetyl)amino]-5-methylanilino]-2-oxoacetate.
| Compound Name | ethyl 2-[2-chloro-3-[(2-ethoxy-2-oxoacetyl)amino]-5-methylanilino]-2-oxoacetate |
|---|---|
| PubChem CID | 12897321 |
| Molecular Formula | C15H17ClN2O6 |
| Molecular Weight | 356.76 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | ethyl 2-[2-chloro-3-[(2-ethoxy-2-oxoacetyl)amino]-5-methylanilino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1cc(C)cc(NC(=O)C(=O)OCC)c1Cl |
| InChI | InChI=1S/C15H17ClN2O6/c1-4-23-14(21)12(19)17-9-6-8(3)7-10(11(9)16)18-13(20)15(22)24-5-2/h6-7H,4-5H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | LOGSNVWFVIKHQZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.76 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|