About ethyl 2-(2,5-dihydroxyanilino)-2-oxoacetate
ethyl 2-(2,5-dihydroxyanilino)-2-oxoacetate (PubChem CID 12803557) has the molecular formula C10H11NO5
and a molecular weight of 225.20 g/mol. Its IUPAC name is ethyl 2-(2,5-dihydroxyanilino)-2-oxoacetate.
Molecular Properties
| Compound Name | ethyl 2-(2,5-dihydroxyanilino)-2-oxoacetate |
| PubChem CID | 12803557 |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | ethyl 2-(2,5-dihydroxyanilino)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1cc(O)ccc1O |
| InChI | InChI=1S/C10H11NO5/c1-2-16-10(15)9(14)11-7-5-6(12)3-4-8(7)13/h3-5,12-13H,2H2,1H3,(H,11,14) |
| InChIKey | OFZNEEPBCMTFHR-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(2,5-dihydroxyanilino)-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2,5-dihydroxyanilino)-2-oxoacetate?
The IUPAC name of ethyl 2-(2,5-dihydroxyanilino)-2-oxoacetate (CID 12803557) is ethyl 2-(2,5-dihydroxyanilino)-2-oxoacetate.
What is the SMILES notation for ethyl 2-(2,5-dihydroxyanilino)-2-oxoacetate?
The canonical SMILES for ethyl 2-(2,5-dihydroxyanilino)-2-oxoacetate is CCOC(=O)C(=O)Nc1cc(O)ccc1O.
What is the InChIKey of ethyl 2-(2,5-dihydroxyanilino)-2-oxoacetate?
The InChIKey is OFZNEEPBCMTFHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO5/c1-2-16-10(15)9(14)11-7-5-6(12)3-4-8(7)13/h3-5,12-13H,2H2,1H3,(H,11,14).
What are the key properties of ethyl 2-(2,5-dihydroxyanilino)-2-oxoacetate?
ethyl 2-(2,5-dihydroxyanilino)-2-oxoacetate has a molecular weight of 225.20 g/mol, XLogP of 0.60, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2,5-dihydroxyanilino)-2-oxoacetate is sourced from PubChem (CID 12803557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).