C10H11ClN2O5S — CID 54221465
ethyl 2-(5-chloro-2-sulfamoylanilino)-2-oxoacetate (PubChem CID 54221465) has the molecular formula C10H11ClN2O5S and a molecular weight of 306.73 g/mol. Its IUPAC name is ethyl 2-(5-chloro-2-sulfamoylanilino)-2-oxoacetate.
| Compound Name | ethyl 2-(5-chloro-2-sulfamoylanilino)-2-oxoacetate |
|---|---|
| PubChem CID | 54221465 |
| Molecular Formula | C10H11ClN2O5S |
| Molecular Weight | 306.73 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | ethyl 2-(5-chloro-2-sulfamoylanilino)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1cc(Cl)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C10H11ClN2O5S/c1-2-18-10(15)9(14)13-7-5-6(11)3-4-8(7)19(12,16)17/h3-5H,2H2,1H3,(H,13,14)(H2,12,16,17) |
| InChIKey | QCWLBHWTFVZYNX-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.73 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|