C12H13ClN2O4 — CID 163220422
ethyl 3-(4-chloro-2-methylanilino)-2-hydroxyimino-3-oxopropanoate (PubChem CID 163220422) has the molecular formula C12H13ClN2O4 and a molecular weight of 284.70 g/mol. Its IUPAC name is ethyl 3-(4-chloro-2-methylanilino)-2-hydroxyimino-3-oxopropanoate.
| Compound Name | ethyl 3-(4-chloro-2-methylanilino)-2-hydroxyimino-3-oxopropanoate |
|---|---|
| PubChem CID | 163220422 |
| Molecular Formula | C12H13ClN2O4 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | ethyl 3-(4-chloro-2-methylanilino)-2-hydroxyimino-3-oxopropanoate |
| SMILES | CCOC(=O)C(=NO)C(=O)Nc1ccc(Cl)cc1C |
| InChI | InChI=1S/C12H13ClN2O4/c1-3-19-12(17)10(15-18)11(16)14-9-5-4-8(13)6-7(9)2/h4-6,18H,3H2,1-2H3,(H,14,16) |
| InChIKey | QZPJJFVZJULWFF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|