C15H17ClN4O6 — CID 135819821
ethyl (2Z,3E)-3-[[2-(5-chloro-2-methoxyanilino)-2-oxoacetyl]hydrazinylidene]-2-hydroxyiminobutanoate (PubChem CID 135819821) has the molecular formula C15H17ClN4O6 and a molecular weight of 384.78 g/mol. Its IUPAC name is ethyl (2Z,3E)-3-[[2-(5-chloro-2-methoxyanilino)-2-oxoacetyl]hydrazinylidene]-2-hydroxyiminobutanoate.
| Compound Name | ethyl (2Z,3E)-3-[[2-(5-chloro-2-methoxyanilino)-2-oxoacetyl]hydrazinylidene]-2-hydroxyiminobutanoate |
|---|---|
| PubChem CID | 135819821 |
| Molecular Formula | C15H17ClN4O6 |
| Molecular Weight | 384.78 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | ethyl (2Z,3E)-3-[[2-(5-chloro-2-methoxyanilino)-2-oxoacetyl]hydrazinylidene]-2-hydroxyiminobutanoate |
| SMILES | CCOC(=O)C(=N\O)/C(C)=N/NC(=O)C(=O)Nc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C15H17ClN4O6/c1-4-26-15(23)12(20-24)8(2)18-19-14(22)13(21)17-10-7-9(16)5-6-11(10)25-3/h5-7,24H,4H2,1-3H3,(H,17,21)(H,19,22)/b18-8+,20-12- |
| InChIKey | BTQAGUDRMGSGTE-RDAZTFGWSA-N |
| XLogP | 1.17 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.78 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|