C14H14Cl2N4O5 — CID 135554220
ethyl (2Z,3E)-3-[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]-2-hydroxyiminobutanoate (PubChem CID 135554220) has the molecular formula C14H14Cl2N4O5 and a molecular weight of 389.20 g/mol. Its IUPAC name is ethyl (2Z,3E)-3-[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]-2-hydroxyiminobutanoate.
| Compound Name | ethyl (2Z,3E)-3-[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]-2-hydroxyiminobutanoate |
|---|---|
| PubChem CID | 135554220 |
| Molecular Formula | C14H14Cl2N4O5 |
| Molecular Weight | 389.20 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | ethyl (2Z,3E)-3-[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]-2-hydroxyiminobutanoate |
| SMILES | CCOC(=O)C(=N\O)/C(C)=N/NC(=O)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H14Cl2N4O5/c1-3-25-14(23)11(20-24)7(2)18-19-13(22)12(21)17-8-4-5-9(15)10(16)6-8/h4-6,24H,3H2,1-2H3,(H,17,21)(H,19,22)/b18-7+,20-11- |
| InChIKey | PPTHXXQKSHKKPW-SYTHRMTFSA-N |
| XLogP | 1.82 |
| TPSA | 129.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|