C17H20Cl2N2O5S — CID 23476441
diethyl 2-[[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-(methylamino)methylidene]propanedioate (PubChem CID 23476441) has the molecular formula C17H20Cl2N2O5S and a molecular weight of 435.33 g/mol. Its IUPAC name is diethyl 2-[[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-(methylamino)methylidene]propanedioate.
| Compound Name | diethyl 2-[[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-(methylamino)methylidene]propanedioate |
|---|---|
| PubChem CID | 23476441 |
| Molecular Formula | C17H20Cl2N2O5S |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | diethyl 2-[[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-(methylamino)methylidene]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)=C(NC)SCC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H20Cl2N2O5S/c1-4-25-16(23)14(17(24)26-5-2)15(20-3)27-9-13(22)21-10-6-7-11(18)12(19)8-10/h6-8,20H,4-5,9H2,1-3H3,(H,21,22) |
| InChIKey | OEWDCGUJSVIYLT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|