C27H18Cl6N6O3S3 — CID 110184146
2-[[4,6-bis[[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl]-1,3,5-triazin-2-yl]sulfanyl]-N-(3,4-dichlorophenyl)acetamide (PubChem CID 110184146) has the molecular formula C27H18Cl6N6O3S3 and a molecular weight of 783.40 g/mol. Its IUPAC name is 2-[[4,6-bis[[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl]-1,3,5-triazin-2-yl]sulfanyl]-N-(3,4-dichlorophenyl)acetamide.
| Compound Name | 2-[[4,6-bis[[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl]-1,3,5-triazin-2-yl]sulfanyl]-N-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 110184146 |
| Molecular Formula | C27H18Cl6N6O3S3 |
| Molecular Weight | 783.40 g/mol |
| Exact Mass | 779.87 |
| IUPAC Name | 2-[[4,6-bis[[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl]-1,3,5-triazin-2-yl]sulfanyl]-N-(3,4-dichlorophenyl)acetamide |
| SMILES | O=C(CSc1nc(SCC(=O)Nc2ccc(Cl)c(Cl)c2)nc(SCC(=O)Nc2ccc(Cl)c(Cl)c2)n1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H18Cl6N6O3S3/c28-16-4-1-13(7-19(16)31)34-22(40)10-43-25-37-26(44-11-23(41)35-14-2-5-17(29)20(32)8-14)39-27(38-25)45-12-24(42)36-15-3-6-18(30)21(33)9-15/h1-9H,10-12H2,(H,34,40)(H,35,41)(H,36,42) |
| InChIKey | PJJAHZNZOOIEHQ-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 125.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.40 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |