C22H18Cl2N2O2S — CID 22781801
N-[4-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanylphenyl]-2-phenylacetamide (PubChem CID 22781801) has the molecular formula C22H18Cl2N2O2S and a molecular weight of 445.37 g/mol. Its IUPAC name is N-[4-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanylphenyl]-2-phenylacetamide.
| Compound Name | N-[4-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanylphenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 22781801 |
| Molecular Formula | C22H18Cl2N2O2S |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | N-[4-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanylphenyl]-2-phenylacetamide |
| SMILES | O=C(CSc1ccc(NC(=O)Cc2ccccc2)cc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H18Cl2N2O2S/c23-19-11-8-17(13-20(19)24)26-22(28)14-29-18-9-6-16(7-10-18)25-21(27)12-15-4-2-1-3-5-15/h1-11,13H,12,14H2,(H,25,27)(H,26,28) |
| InChIKey | DLJROPAUXQCJCN-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |