C17H18N2O2S — CID 134062919
N-methyl-2-[4-[(2-phenylsulfanylacetyl)amino]phenyl]acetamide (PubChem CID 134062919) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is N-methyl-2-[4-[(2-phenylsulfanylacetyl)amino]phenyl]acetamide.
| Compound Name | N-methyl-2-[4-[(2-phenylsulfanylacetyl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 134062919 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-methyl-2-[4-[(2-phenylsulfanylacetyl)amino]phenyl]acetamide |
| SMILES | CNC(=O)Cc1ccc(NC(=O)CSc2ccccc2)cc1 |
| InChI | InChI=1S/C17H18N2O2S/c1-18-16(20)11-13-7-9-14(10-8-13)19-17(21)12-22-15-5-3-2-4-6-15/h2-10H,11-12H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | ORQLAJONHLFYEC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |