C22H21NO2S2 — CID 28565140
2-(4-methoxyphenyl)sulfanyl-N-[4-(phenylsulfanylmethyl)phenyl]acetamide (PubChem CID 28565140) has the molecular formula C22H21NO2S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)sulfanyl-N-[4-(phenylsulfanylmethyl)phenyl]acetamide.
| Compound Name | 2-(4-methoxyphenyl)sulfanyl-N-[4-(phenylsulfanylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 28565140 |
| Molecular Formula | C22H21NO2S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 2-(4-methoxyphenyl)sulfanyl-N-[4-(phenylsulfanylmethyl)phenyl]acetamide |
| SMILES | COc1ccc(SCC(=O)Nc2ccc(CSc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C22H21NO2S2/c1-25-19-11-13-21(14-12-19)27-16-22(24)23-18-9-7-17(8-10-18)15-26-20-5-3-2-4-6-20/h2-14H,15-16H2,1H3,(H,23,24) |
| InChIKey | IYURZJITNOWOBS-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |