C18H17N3O2S3 — CID 30996869
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-methoxyphenyl)sulfanylacetamide (PubChem CID 30996869) has the molecular formula C18H17N3O2S3 and a molecular weight of 403.55 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-methoxyphenyl)sulfanylacetamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-methoxyphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 30996869 |
| Molecular Formula | C18H17N3O2S3 |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-methoxyphenyl)sulfanylacetamide |
| SMILES | COc1ccc(SCC(=O)Nc2nnc(SCc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C18H17N3O2S3/c1-23-14-7-9-15(10-8-14)24-12-16(22)19-17-20-21-18(26-17)25-11-13-5-3-2-4-6-13/h2-10H,11-12H2,1H3,(H,19,20,22) |
| InChIKey | QXXGEUDIEOHFRN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|