C20H22N4O5S3 — CID 100560440
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(2,4-dimethoxy-N-methylsulfonylanilino)acetamide (PubChem CID 100560440) has the molecular formula C20H22N4O5S3 and a molecular weight of 494.62 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(2,4-dimethoxy-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(2,4-dimethoxy-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 100560440 |
| Molecular Formula | C20H22N4O5S3 |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(2,4-dimethoxy-N-methylsulfonylanilino)acetamide |
| SMILES | COc1ccc(N(CC(=O)Nc2nnc(SCc3ccccc3)s2)S(C)(=O)=O)c(OC)c1 |
| InChI | InChI=1S/C20H22N4O5S3/c1-28-15-9-10-16(17(11-15)29-2)24(32(3,26)27)12-18(25)21-19-22-23-20(31-19)30-13-14-7-5-4-6-8-14/h4-11H,12-13H2,1-3H3,(H,21,22,25) |
| InChIKey | ZQRFSBTXMMWNQU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|