C23H18Cl2N4O3S3 — CID 100757719
2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 100757719) has the molecular formula C23H18Cl2N4O3S3 and a molecular weight of 565.53 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 100757719 |
| Molecular Formula | C23H18Cl2N4O3S3 |
| Molecular Weight | 565.53 g/mol |
| Exact Mass | 563.99 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | O=C(CN(c1cc(Cl)cc(Cl)c1)S(=O)(=O)c1ccccc1)Nc1nnc(SCc2ccccc2)s1 |
| InChI | InChI=1S/C23H18Cl2N4O3S3/c24-17-11-18(25)13-19(12-17)29(35(31,32)20-9-5-2-6-10-20)14-21(30)26-22-27-28-23(34-22)33-15-16-7-3-1-4-8-16/h1-13H,14-15H2,(H,26,27,30) |
| InChIKey | ZLCHZMKYDNHWFG-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|