C25H22N4O6S3 — CID 100522405
methyl 2-[[5-[[2-[N-(benzenesulfonyl)-4-phenoxyanilino]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 100522405) has the molecular formula C25H22N4O6S3 and a molecular weight of 570.67 g/mol. Its IUPAC name is methyl 2-[[5-[[2-[N-(benzenesulfonyl)-4-phenoxyanilino]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[5-[[2-[N-(benzenesulfonyl)-4-phenoxyanilino]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 100522405 |
| Molecular Formula | C25H22N4O6S3 |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.07 |
| IUPAC Name | methyl 2-[[5-[[2-[N-(benzenesulfonyl)-4-phenoxyanilino]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1nnc(NC(=O)CN(c2ccc(Oc3ccccc3)cc2)S(=O)(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C25H22N4O6S3/c1-34-23(31)17-36-25-28-27-24(37-25)26-22(30)16-29(38(32,33)21-10-6-3-7-11-21)18-12-14-20(15-13-18)35-19-8-4-2-5-9-19/h2-15H,16-17H2,1H3,(H,26,27,30) |
| InChIKey | LPMYENVZEHWATE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|