C26H24N4O6S3 — CID 100585196
methyl 2-[[5-[[2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 100585196) has the molecular formula C26H24N4O6S3 and a molecular weight of 584.70 g/mol. Its IUPAC name is methyl 2-[[5-[[2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[5-[[2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 100585196 |
| Molecular Formula | C26H24N4O6S3 |
| Molecular Weight | 584.70 g/mol |
| Exact Mass | 584.09 |
| IUPAC Name | methyl 2-[[5-[[2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1nnc(NC(=O)CN(c2ccc(Oc3ccccc3)cc2)S(=O)(=O)c2ccc(C)cc2)s1 |
| InChI | InChI=1S/C26H24N4O6S3/c1-18-8-14-22(15-9-18)39(33,34)30(19-10-12-21(13-11-19)36-20-6-4-3-5-7-20)16-23(31)27-25-28-29-26(38-25)37-17-24(32)35-2/h3-15H,16-17H2,1-2H3,(H,27,28,31) |
| InChIKey | YNIVOIRVTRHWAA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.70 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|