C26H23ClN4O5S3 — CID 100713212
methyl 2-[[5-[[2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]benzoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 100713212) has the molecular formula C26H23ClN4O5S3 and a molecular weight of 603.15 g/mol. Its IUPAC name is methyl 2-[[5-[[2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]benzoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[5-[[2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]benzoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 100713212 |
| Molecular Formula | C26H23ClN4O5S3 |
| Molecular Weight | 603.15 g/mol |
| Exact Mass | 602.05 |
| IUPAC Name | methyl 2-[[5-[[2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]benzoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1nnc(NC(=O)c2ccccc2N(Cc2ccc(Cl)cc2)S(=O)(=O)c2ccc(C)cc2)s1 |
| InChI | InChI=1S/C26H23ClN4O5S3/c1-17-7-13-20(14-8-17)39(34,35)31(15-18-9-11-19(27)12-10-18)22-6-4-3-5-21(22)24(33)28-25-29-30-26(38-25)37-16-23(32)36-2/h3-14H,15-16H2,1-2H3,(H,28,29,33) |
| InChIKey | YQXXZZZRKOQFQY-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.15 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|