C33H28N2O4S — CID 126415624
2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)-N-(2-phenylphenyl)acetamide (PubChem CID 126415624) has the molecular formula C33H28N2O4S and a molecular weight of 548.66 g/mol. Its IUPAC name is 2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)-N-(2-phenylphenyl)acetamide.
| Compound Name | 2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)-N-(2-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 126415624 |
| Molecular Formula | C33H28N2O4S |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | 2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)-N-(2-phenylphenyl)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccccc2-c2ccccc2)c2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C33H28N2O4S/c1-25-16-22-30(23-17-25)40(37,38)35(27-18-20-29(21-19-27)39-28-12-6-3-7-13-28)24-33(36)34-32-15-9-8-14-31(32)26-10-4-2-5-11-26/h2-23H,24H2,1H3,(H,34,36) |
| InChIKey | VUKVWYYAJJARFU-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |