C33H27ClN2O5S — CID 4565026
N-(5-chloro-2-phenoxyphenyl)-2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)acetamide (PubChem CID 4565026) has the molecular formula C33H27ClN2O5S and a molecular weight of 599.11 g/mol. Its IUPAC name is N-(5-chloro-2-phenoxyphenyl)-2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)acetamide.
| Compound Name | N-(5-chloro-2-phenoxyphenyl)-2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)acetamide |
|---|---|
| PubChem CID | 4565026 |
| Molecular Formula | C33H27ClN2O5S |
| Molecular Weight | 599.11 g/mol |
| Exact Mass | 598.13 |
| IUPAC Name | N-(5-chloro-2-phenoxyphenyl)-2-(N-(4-methylphenyl)sulfonyl-4-phenoxyanilino)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)Nc2cc(Cl)ccc2Oc2ccccc2)c2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C33H27ClN2O5S/c1-24-12-19-30(20-13-24)42(38,39)36(26-15-17-29(18-16-26)40-27-8-4-2-5-9-27)23-33(37)35-31-22-25(34)14-21-32(31)41-28-10-6-3-7-11-28/h2-22H,23H2,1H3,(H,35,37) |
| InChIKey | HBIUYBNCNXEGIZ-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.11 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |