C29H27ClN2O5S — CID 17247356
N-(5-chloro-2-phenoxyphenyl)-2-[4-[ethyl-(4-methylphenyl)sulfonylamino]phenoxy]acetamide (PubChem CID 17247356) has the molecular formula C29H27ClN2O5S and a molecular weight of 551.06 g/mol. Its IUPAC name is N-(5-chloro-2-phenoxyphenyl)-2-[4-[ethyl-(4-methylphenyl)sulfonylamino]phenoxy]acetamide.
| Compound Name | N-(5-chloro-2-phenoxyphenyl)-2-[4-[ethyl-(4-methylphenyl)sulfonylamino]phenoxy]acetamide |
|---|---|
| PubChem CID | 17247356 |
| Molecular Formula | C29H27ClN2O5S |
| Molecular Weight | 551.06 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | N-(5-chloro-2-phenoxyphenyl)-2-[4-[ethyl-(4-methylphenyl)sulfonylamino]phenoxy]acetamide |
| SMILES | CCN(c1ccc(OCC(=O)Nc2cc(Cl)ccc2Oc2ccccc2)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H27ClN2O5S/c1-3-32(38(34,35)26-16-9-21(2)10-17-26)23-12-14-24(15-13-23)36-20-29(33)31-27-19-22(30)11-18-28(27)37-25-7-5-4-6-8-25/h4-19H,3,20H2,1-2H3,(H,31,33) |
| InChIKey | OGUVFYNOWMDLGN-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.06 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |