C27H22Cl2N2O4S — CID 126273783
2-(2-chloro-N-(4-methylphenyl)sulfonylanilino)-N-(5-chloro-2-phenoxyphenyl)acetamide (PubChem CID 126273783) has the molecular formula C27H22Cl2N2O4S and a molecular weight of 541.46 g/mol. Its IUPAC name is 2-(2-chloro-N-(4-methylphenyl)sulfonylanilino)-N-(5-chloro-2-phenoxyphenyl)acetamide.
| Compound Name | 2-(2-chloro-N-(4-methylphenyl)sulfonylanilino)-N-(5-chloro-2-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126273783 |
| Molecular Formula | C27H22Cl2N2O4S |
| Molecular Weight | 541.46 g/mol |
| Exact Mass | 540.07 |
| IUPAC Name | 2-(2-chloro-N-(4-methylphenyl)sulfonylanilino)-N-(5-chloro-2-phenoxyphenyl)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)Nc2cc(Cl)ccc2Oc2ccccc2)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C27H22Cl2N2O4S/c1-19-11-14-22(15-12-19)36(33,34)31(25-10-6-5-9-23(25)29)18-27(32)30-24-17-20(28)13-16-26(24)35-21-7-3-2-4-8-21/h2-17H,18H2,1H3,(H,30,32) |
| InChIKey | WMCMIGBAJURWIN-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.46 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |