C32H25ClN2O5S — CID 126415335
2-[N-(benzenesulfonyl)-4-phenoxyanilino]-N-(5-chloro-2-phenoxyphenyl)acetamide (PubChem CID 126415335) has the molecular formula C32H25ClN2O5S and a molecular weight of 585.08 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-phenoxyanilino]-N-(5-chloro-2-phenoxyphenyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-phenoxyanilino]-N-(5-chloro-2-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126415335 |
| Molecular Formula | C32H25ClN2O5S |
| Molecular Weight | 585.08 g/mol |
| Exact Mass | 584.12 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-phenoxyanilino]-N-(5-chloro-2-phenoxyphenyl)acetamide |
| SMILES | O=C(CN(c1ccc(Oc2ccccc2)cc1)S(=O)(=O)c1ccccc1)Nc1cc(Cl)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C32H25ClN2O5S/c33-24-16-21-31(40-27-12-6-2-7-13-27)30(22-24)34-32(36)23-35(41(37,38)29-14-8-3-9-15-29)25-17-19-28(20-18-25)39-26-10-4-1-5-11-26/h1-22H,23H2,(H,34,36) |
| InChIKey | BXCUAODLYBJJAC-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.08 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |