C24H21ClN4O3S3 — CID 100657229
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(3-chloro-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 100657229) has the molecular formula C24H21ClN4O3S3 and a molecular weight of 545.11 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(3-chloro-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(3-chloro-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 100657229 |
| Molecular Formula | C24H21ClN4O3S3 |
| Molecular Weight | 545.11 g/mol |
| Exact Mass | 544.05 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(3-chloro-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)Nc2nnc(SCc3ccccc3)s2)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C24H21ClN4O3S3/c1-17-10-12-21(13-11-17)35(31,32)29(20-9-5-8-19(25)14-20)15-22(30)26-23-27-28-24(34-23)33-16-18-6-3-2-4-7-18/h2-14H,15-16H2,1H3,(H,26,27,30) |
| InChIKey | DRKKDTFHWXPIEL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.11 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|