C20H20N4O6S3 — CID 100544461
methyl 2-[[5-[[2-[N-(benzenesulfonyl)-3-methoxyanilino]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 100544461) has the molecular formula C20H20N4O6S3 and a molecular weight of 508.60 g/mol. Its IUPAC name is methyl 2-[[5-[[2-[N-(benzenesulfonyl)-3-methoxyanilino]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[5-[[2-[N-(benzenesulfonyl)-3-methoxyanilino]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 100544461 |
| Molecular Formula | C20H20N4O6S3 |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | methyl 2-[[5-[[2-[N-(benzenesulfonyl)-3-methoxyanilino]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1nnc(NC(=O)CN(c2cccc(OC)c2)S(=O)(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C20H20N4O6S3/c1-29-15-8-6-7-14(11-15)24(33(27,28)16-9-4-3-5-10-16)12-17(25)21-19-22-23-20(32-19)31-13-18(26)30-2/h3-11H,12-13H2,1-2H3,(H,21,22,25) |
| InChIKey | LYYICTSYFAYMPD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|