C26H26N4O3S3 — CID 100565729
2-[N-(benzenesulfonyl)-4-propan-2-ylanilino]-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 100565729) has the molecular formula C26H26N4O3S3 and a molecular weight of 538.72 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-propan-2-ylanilino]-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-propan-2-ylanilino]-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 100565729 |
| Molecular Formula | C26H26N4O3S3 |
| Molecular Weight | 538.72 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-propan-2-ylanilino]-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CC(C)c1ccc(N(CC(=O)Nc2nnc(SCc3ccccc3)s2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H26N4O3S3/c1-19(2)21-13-15-22(16-14-21)30(36(32,33)23-11-7-4-8-12-23)17-24(31)27-25-28-29-26(35-25)34-18-20-9-5-3-6-10-20/h3-16,19H,17-18H2,1-2H3,(H,27,28,31) |
| InChIKey | UPJVNGDTQGCLAG-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.72 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|