C19H20N4O4S3 — CID 100722218
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(2-methoxy-N-methylsulfonylanilino)acetamide (PubChem CID 100722218) has the molecular formula C19H20N4O4S3 and a molecular weight of 464.59 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(2-methoxy-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(2-methoxy-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 100722218 |
| Molecular Formula | C19H20N4O4S3 |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(2-methoxy-N-methylsulfonylanilino)acetamide |
| SMILES | COc1ccccc1N(CC(=O)Nc1nnc(SCc2ccccc2)s1)S(C)(=O)=O |
| InChI | InChI=1S/C19H20N4O4S3/c1-27-16-11-7-6-10-15(16)23(30(2,25)26)12-17(24)20-18-21-22-19(29-18)28-13-14-8-4-3-5-9-14/h3-11H,12-13H2,1-2H3,(H,20,21,24) |
| InChIKey | JSIAFAQUKJMKOZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|