C18H24N4O6S3 — CID 100552200
methyl 2-[[5-[4-(2-ethoxy-N-methylsulfonylanilino)butanoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 100552200) has the molecular formula C18H24N4O6S3 and a molecular weight of 488.61 g/mol. Its IUPAC name is methyl 2-[[5-[4-(2-ethoxy-N-methylsulfonylanilino)butanoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[5-[4-(2-ethoxy-N-methylsulfonylanilino)butanoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 100552200 |
| Molecular Formula | C18H24N4O6S3 |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | methyl 2-[[5-[4-(2-ethoxy-N-methylsulfonylanilino)butanoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOc1ccccc1N(CCCC(=O)Nc1nnc(SCC(=O)OC)s1)S(C)(=O)=O |
| InChI | InChI=1S/C18H24N4O6S3/c1-4-28-14-9-6-5-8-13(14)22(31(3,25)26)11-7-10-15(23)19-17-20-21-18(30-17)29-12-16(24)27-2/h5-6,8-9H,4,7,10-12H2,1-3H3,(H,19,20,23) |
| InChIKey | SERPJTZSROTSSH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|