C16H22N4O4S3 — CID 100741089
4-(2-ethoxy-N-methylsulfonylanilino)-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 100741089) has the molecular formula C16H22N4O4S3 and a molecular weight of 430.58 g/mol. Its IUPAC name is 4-(2-ethoxy-N-methylsulfonylanilino)-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | 4-(2-ethoxy-N-methylsulfonylanilino)-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 100741089 |
| Molecular Formula | C16H22N4O4S3 |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 4-(2-ethoxy-N-methylsulfonylanilino)-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | CCOc1ccccc1N(CCCC(=O)Nc1nnc(SC)s1)S(C)(=O)=O |
| InChI | InChI=1S/C16H22N4O4S3/c1-4-24-13-9-6-5-8-12(13)20(27(3,22)23)11-7-10-14(21)17-15-18-19-16(25-2)26-15/h5-6,8-9H,4,7,10-11H2,1-3H3,(H,17,18,21) |
| InChIKey | PDZBQBFOOLEOAT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|