C18H24N4O3S3 — CID 100570876
4-(2,3-dimethyl-N-methylsulfonylanilino)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 100570876) has the molecular formula C18H24N4O3S3 and a molecular weight of 440.62 g/mol. Its IUPAC name is 4-(2,3-dimethyl-N-methylsulfonylanilino)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | 4-(2,3-dimethyl-N-methylsulfonylanilino)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 100570876 |
| Molecular Formula | C18H24N4O3S3 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 4-(2,3-dimethyl-N-methylsulfonylanilino)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | C=CCSc1nnc(NC(=O)CCCN(c2cccc(C)c2C)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C18H24N4O3S3/c1-5-12-26-18-21-20-17(27-18)19-16(23)10-7-11-22(28(4,24)25)15-9-6-8-13(2)14(15)3/h5-6,8-9H,1,7,10-12H2,2-4H3,(H,19,20,23) |
| InChIKey | PRDWYFJPLJWZHX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|