C15H15F3N4O3S3 — CID 100764146
2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 100764146) has the molecular formula C15H15F3N4O3S3 and a molecular weight of 452.51 g/mol. Its IUPAC name is 2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 100764146 |
| Molecular Formula | C15H15F3N4O3S3 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | 2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | C=CCSc1nnc(NC(=O)CN(c2cccc(C(F)(F)F)c2)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C15H15F3N4O3S3/c1-3-7-26-14-21-20-13(27-14)19-12(23)9-22(28(2,24)25)11-6-4-5-10(8-11)15(16,17)18/h3-6,8H,1,7,9H2,2H3,(H,19,20,23) |
| InChIKey | KCSMCZYTRMJNBQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|