C21H28N2O5S — CID 53286543
N-(3,4-dimethoxyphenyl)-4-(2,3-dimethyl-N-methylsulfonylanilino)butanamide (PubChem CID 53286543) has the molecular formula C21H28N2O5S and a molecular weight of 420.53 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-4-(2,3-dimethyl-N-methylsulfonylanilino)butanamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-4-(2,3-dimethyl-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 53286543 |
| Molecular Formula | C21H28N2O5S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-4-(2,3-dimethyl-N-methylsulfonylanilino)butanamide |
| SMILES | COc1ccc(NC(=O)CCCN(c2cccc(C)c2C)S(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C21H28N2O5S/c1-15-8-6-9-18(16(15)2)23(29(5,25)26)13-7-10-21(24)22-17-11-12-19(27-3)20(14-17)28-4/h6,8-9,11-12,14H,7,10,13H2,1-5H3,(H,22,24) |
| InChIKey | MJZYUXGSBRTQQW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |