C18H20F2N2O4S — CID 53288261
N-(3,4-difluorophenyl)-4-(2-methoxy-N-methylsulfonylanilino)butanamide (PubChem CID 53288261) has the molecular formula C18H20F2N2O4S and a molecular weight of 398.43 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-4-(2-methoxy-N-methylsulfonylanilino)butanamide.
| Compound Name | N-(3,4-difluorophenyl)-4-(2-methoxy-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 53288261 |
| Molecular Formula | C18H20F2N2O4S |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | N-(3,4-difluorophenyl)-4-(2-methoxy-N-methylsulfonylanilino)butanamide |
| SMILES | COc1ccccc1N(CCCC(=O)Nc1ccc(F)c(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C18H20F2N2O4S/c1-26-17-7-4-3-6-16(17)22(27(2,24)25)11-5-8-18(23)21-13-9-10-14(19)15(20)12-13/h3-4,6-7,9-10,12H,5,8,11H2,1-2H3,(H,21,23) |
| InChIKey | RDSZHRRGLFUGBX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |