C24H33N3O6S2 — CID 100581767
N-[4-(azepan-1-ylsulfonyl)phenyl]-4-(2-methoxy-N-methylsulfonylanilino)butanamide (PubChem CID 100581767) has the molecular formula C24H33N3O6S2 and a molecular weight of 523.68 g/mol. Its IUPAC name is N-[4-(azepan-1-ylsulfonyl)phenyl]-4-(2-methoxy-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-4-(2-methoxy-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 100581767 |
| Molecular Formula | C24H33N3O6S2 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-4-(2-methoxy-N-methylsulfonylanilino)butanamide |
| SMILES | COc1ccccc1N(CCCC(=O)Nc1ccc(S(=O)(=O)N2CCCCCC2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C24H33N3O6S2/c1-33-23-11-6-5-10-22(23)27(34(2,29)30)19-9-12-24(28)25-20-13-15-21(16-14-20)35(31,32)26-17-7-3-4-8-18-26/h5-6,10-11,13-16H,3-4,7-9,12,17-19H2,1-2H3,(H,25,28) |
| InChIKey | GQBJLSZYZPUGNY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |