C21H26FN3O5S2 — CID 21367388
4-(4-fluoro-N-methylsulfonylanilino)-N-(4-pyrrolidin-1-ylsulfonylphenyl)butanamide (PubChem CID 21367388) has the molecular formula C21H26FN3O5S2 and a molecular weight of 483.59 g/mol. Its IUPAC name is 4-(4-fluoro-N-methylsulfonylanilino)-N-(4-pyrrolidin-1-ylsulfonylphenyl)butanamide.
| Compound Name | 4-(4-fluoro-N-methylsulfonylanilino)-N-(4-pyrrolidin-1-ylsulfonylphenyl)butanamide |
|---|---|
| PubChem CID | 21367388 |
| Molecular Formula | C21H26FN3O5S2 |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 4-(4-fluoro-N-methylsulfonylanilino)-N-(4-pyrrolidin-1-ylsulfonylphenyl)butanamide |
| SMILES | CS(=O)(=O)N(CCCC(=O)Nc1ccc(S(=O)(=O)N2CCCC2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H26FN3O5S2/c1-31(27,28)25(19-10-6-17(22)7-11-19)16-4-5-21(26)23-18-8-12-20(13-9-18)32(29,30)24-14-2-3-15-24/h6-13H,2-5,14-16H2,1H3,(H,23,26) |
| InChIKey | QLWRKZISJNJXKT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |