C23H23BrFN3O5S2 — CID 21367689
N-[4-[(4-bromophenyl)sulfamoyl]phenyl]-4-(4-fluoro-N-methylsulfonylanilino)butanamide (PubChem CID 21367689) has the molecular formula C23H23BrFN3O5S2 and a molecular weight of 584.49 g/mol. Its IUPAC name is N-[4-[(4-bromophenyl)sulfamoyl]phenyl]-4-(4-fluoro-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[4-[(4-bromophenyl)sulfamoyl]phenyl]-4-(4-fluoro-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 21367689 |
| Molecular Formula | C23H23BrFN3O5S2 |
| Molecular Weight | 584.49 g/mol |
| Exact Mass | 583.02 |
| IUPAC Name | N-[4-[(4-bromophenyl)sulfamoyl]phenyl]-4-(4-fluoro-N-methylsulfonylanilino)butanamide |
| SMILES | CS(=O)(=O)N(CCCC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(Br)cc2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H23BrFN3O5S2/c1-34(30,31)28(21-12-6-18(25)7-13-21)16-2-3-23(29)26-19-10-14-22(15-11-19)35(32,33)27-20-8-4-17(24)5-9-20/h4-15,27H,2-3,16H2,1H3,(H,26,29) |
| InChIKey | SGBTVBLCTAZOKI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |