C21H19BrFN3O5S2 — CID 43882152
2-(2-bromo-N-methylsulfonylanilino)-N-[4-[(4-fluorophenyl)sulfamoyl]phenyl]acetamide (PubChem CID 43882152) has the molecular formula C21H19BrFN3O5S2 and a molecular weight of 556.44 g/mol. Its IUPAC name is 2-(2-bromo-N-methylsulfonylanilino)-N-[4-[(4-fluorophenyl)sulfamoyl]phenyl]acetamide.
| Compound Name | 2-(2-bromo-N-methylsulfonylanilino)-N-[4-[(4-fluorophenyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 43882152 |
| Molecular Formula | C21H19BrFN3O5S2 |
| Molecular Weight | 556.44 g/mol |
| Exact Mass | 554.99 |
| IUPAC Name | 2-(2-bromo-N-methylsulfonylanilino)-N-[4-[(4-fluorophenyl)sulfamoyl]phenyl]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1)c1ccccc1Br |
| InChI | InChI=1S/C21H19BrFN3O5S2/c1-32(28,29)26(20-5-3-2-4-19(20)22)14-21(27)24-16-10-12-18(13-11-16)33(30,31)25-17-8-6-15(23)7-9-17/h2-13,25H,14H2,1H3,(H,24,27) |
| InChIKey | HOMYFRVOMUZECN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |