C23H24ClN3O6S2 — CID 4155954
N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-2-(2-ethoxy-N-methylsulfonylanilino)acetamide (PubChem CID 4155954) has the molecular formula C23H24ClN3O6S2 and a molecular weight of 538.05 g/mol. Its IUPAC name is N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-2-(2-ethoxy-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-2-(2-ethoxy-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 4155954 |
| Molecular Formula | C23H24ClN3O6S2 |
| Molecular Weight | 538.05 g/mol |
| Exact Mass | 537.08 |
| IUPAC Name | N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-2-(2-ethoxy-N-methylsulfonylanilino)acetamide |
| SMILES | CCOc1ccccc1N(CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(Cl)cc2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C23H24ClN3O6S2/c1-3-33-22-7-5-4-6-21(22)27(34(2,29)30)16-23(28)25-18-12-14-20(15-13-18)35(31,32)26-19-10-8-17(24)9-11-19/h4-15,26H,3,16H2,1-2H3,(H,25,28) |
| InChIKey | LXAZBQNTPSRCQC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.05 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |