C28H26ClN3O6S2 — CID 126190753
2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)-N-[4-(phenylsulfamoyl)phenyl]acetamide (PubChem CID 126190753) has the molecular formula C28H26ClN3O6S2 and a molecular weight of 600.12 g/mol. Its IUPAC name is 2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)-N-[4-(phenylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)-N-[4-(phenylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 126190753 |
| Molecular Formula | C28H26ClN3O6S2 |
| Molecular Weight | 600.12 g/mol |
| Exact Mass | 599.10 |
| IUPAC Name | 2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)-N-[4-(phenylsulfamoyl)phenyl]acetamide |
| SMILES | CCOc1ccccc1N(CC(=O)Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H26ClN3O6S2/c1-2-38-27-11-7-6-10-26(27)32(40(36,37)25-16-12-21(29)13-17-25)20-28(33)30-22-14-18-24(19-15-22)39(34,35)31-23-8-4-3-5-9-23/h3-19,31H,2,20H2,1H3,(H,30,33) |
| InChIKey | YONMRDZORZIQOR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.12 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |