C18H31N3O3S — CID 100727714
N-[3-(dimethylamino)propyl]-4-(2,3-dimethyl-N-methylsulfonylanilino)butanamide (PubChem CID 100727714) has the molecular formula C18H31N3O3S and a molecular weight of 369.53 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-4-(2,3-dimethyl-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[3-(dimethylamino)propyl]-4-(2,3-dimethyl-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 100727714 |
| Molecular Formula | C18H31N3O3S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4-(2,3-dimethyl-N-methylsulfonylanilino)butanamide |
| SMILES | Cc1cccc(N(CCCC(=O)NCCCN(C)C)S(C)(=O)=O)c1C |
| InChI | InChI=1S/C18H31N3O3S/c1-15-9-6-10-17(16(15)2)21(25(5,23)24)14-7-11-18(22)19-12-8-13-20(3)4/h6,9-10H,7-8,11-14H2,1-5H3,(H,19,22) |
| InChIKey | SJNKHRULRXKVJU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|