C22H37N3O3S — CID 100511214
N-[3-(azepan-1-yl)propyl]-4-(2,3-dimethyl-N-methylsulfonylanilino)butanamide (PubChem CID 100511214) has the molecular formula C22H37N3O3S and a molecular weight of 423.62 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-4-(2,3-dimethyl-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[3-(azepan-1-yl)propyl]-4-(2,3-dimethyl-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 100511214 |
| Molecular Formula | C22H37N3O3S |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-4-(2,3-dimethyl-N-methylsulfonylanilino)butanamide |
| SMILES | Cc1cccc(N(CCCC(=O)NCCCN2CCCCCC2)S(C)(=O)=O)c1C |
| InChI | InChI=1S/C22H37N3O3S/c1-19-11-8-12-21(20(19)2)25(29(3,27)28)18-9-13-22(26)23-14-10-17-24-15-6-4-5-7-16-24/h8,11-12H,4-7,9-10,13-18H2,1-3H3,(H,23,26) |
| InChIKey | ZPCBUUJXVYCXKX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|