C23H39N3O3S — CID 100710774
4-(2,3-dimethyl-N-methylsulfonylanilino)-N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]butanamide (PubChem CID 100710774) has the molecular formula C23H39N3O3S and a molecular weight of 437.65 g/mol. Its IUPAC name is 4-(2,3-dimethyl-N-methylsulfonylanilino)-N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]butanamide.
| Compound Name | 4-(2,3-dimethyl-N-methylsulfonylanilino)-N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]butanamide |
|---|---|
| PubChem CID | 100710774 |
| Molecular Formula | C23H39N3O3S |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 4-(2,3-dimethyl-N-methylsulfonylanilino)-N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]butanamide |
| SMILES | CC[C@@H]1CCCCN1CCCNC(=O)CCCN(c1cccc(C)c1C)S(C)(=O)=O |
| InChI | InChI=1S/C23H39N3O3S/c1-5-21-12-6-7-16-25(21)17-10-15-24-23(27)14-9-18-26(30(4,28)29)22-13-8-11-19(2)20(22)3/h8,11,13,21H,5-7,9-10,12,14-18H2,1-4H3,(H,24,27)/t21-/m1/s1 |
| InChIKey | SQOPHEXCVUDCCK-OAQYLSRUSA-N |
| XLogP | 3.62 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|