C20H33FN4O3S — CID 43905897
2-[N-(dimethylsulfamoyl)-2-fluoroanilino]-N-[3-(2-ethylpiperidin-1-yl)propyl]acetamide (PubChem CID 43905897) has the molecular formula C20H33FN4O3S and a molecular weight of 428.57 g/mol. Its IUPAC name is 2-[N-(dimethylsulfamoyl)-2-fluoroanilino]-N-[3-(2-ethylpiperidin-1-yl)propyl]acetamide.
| Compound Name | 2-[N-(dimethylsulfamoyl)-2-fluoroanilino]-N-[3-(2-ethylpiperidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 43905897 |
| Molecular Formula | C20H33FN4O3S |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 2-[N-(dimethylsulfamoyl)-2-fluoroanilino]-N-[3-(2-ethylpiperidin-1-yl)propyl]acetamide |
| SMILES | CCC1CCCCN1CCCNC(=O)CN(c1ccccc1F)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C20H33FN4O3S/c1-4-17-10-7-8-14-24(17)15-9-13-22-20(26)16-25(29(27,28)23(2)3)19-12-6-5-11-18(19)21/h5-6,11-12,17H,4,7-10,13-16H2,1-3H3,(H,22,26) |
| InChIKey | MYUSUXHKAZCNSV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|