C20H33N3O3S2 — CID 133200145
N-[3-(2-ethylpiperidin-1-yl)propyl]-2-[methyl-(4-methylsulfanylphenyl)sulfonylamino]acetamide (PubChem CID 133200145) has the molecular formula C20H33N3O3S2 and a molecular weight of 427.64 g/mol. Its IUPAC name is N-[3-(2-ethylpiperidin-1-yl)propyl]-2-[methyl-(4-methylsulfanylphenyl)sulfonylamino]acetamide.
| Compound Name | N-[3-(2-ethylpiperidin-1-yl)propyl]-2-[methyl-(4-methylsulfanylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 133200145 |
| Molecular Formula | C20H33N3O3S2 |
| Molecular Weight | 427.64 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | N-[3-(2-ethylpiperidin-1-yl)propyl]-2-[methyl-(4-methylsulfanylphenyl)sulfonylamino]acetamide |
| SMILES | CCC1CCCCN1CCCNC(=O)CN(C)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C20H33N3O3S2/c1-4-17-8-5-6-14-23(17)15-7-13-21-20(24)16-22(2)28(25,26)19-11-9-18(27-3)10-12-19/h9-12,17H,4-8,13-16H2,1-3H3,(H,21,24) |
| InChIKey | BZFOWUFVBAGHIG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.64 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|