C24H32N4O5S — CID 43893316
2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[3-(2-ethylpiperidin-1-yl)propyl]acetamide (PubChem CID 43893316) has the molecular formula C24H32N4O5S and a molecular weight of 488.61 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[3-(2-ethylpiperidin-1-yl)propyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[3-(2-ethylpiperidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 43893316 |
| Molecular Formula | C24H32N4O5S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[3-(2-ethylpiperidin-1-yl)propyl]acetamide |
| SMILES | CCC1CCCCN1CCCNC(=O)CN(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H32N4O5S/c1-2-20-9-6-7-17-26(20)18-8-16-25-24(29)19-27(21-12-14-22(15-13-21)28(30)31)34(32,33)23-10-4-3-5-11-23/h3-5,10-15,20H,2,6-9,16-19H2,1H3,(H,25,29) |
| InChIKey | YHXAUHYPESXMIP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|