C23H37N3O5S — CID 133162413
4-[2,3-dihydro-1,4-benzodioxin-6-yl(methylsulfonyl)amino]-N-[3-(2-ethylpiperidin-1-yl)propyl]butanamide (PubChem CID 133162413) has the molecular formula C23H37N3O5S and a molecular weight of 467.63 g/mol. Its IUPAC name is 4-[2,3-dihydro-1,4-benzodioxin-6-yl(methylsulfonyl)amino]-N-[3-(2-ethylpiperidin-1-yl)propyl]butanamide.
| Compound Name | 4-[2,3-dihydro-1,4-benzodioxin-6-yl(methylsulfonyl)amino]-N-[3-(2-ethylpiperidin-1-yl)propyl]butanamide |
|---|---|
| PubChem CID | 133162413 |
| Molecular Formula | C23H37N3O5S |
| Molecular Weight | 467.63 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 4-[2,3-dihydro-1,4-benzodioxin-6-yl(methylsulfonyl)amino]-N-[3-(2-ethylpiperidin-1-yl)propyl]butanamide |
| SMILES | CCC1CCCCN1CCCNC(=O)CCCN(c1ccc2c(c1)OCCO2)S(C)(=O)=O |
| InChI | InChI=1S/C23H37N3O5S/c1-3-19-8-4-5-13-25(19)14-7-12-24-23(27)9-6-15-26(32(2,28)29)20-10-11-21-22(18-20)31-17-16-30-21/h10-11,18-19H,3-9,12-17H2,1-2H3,(H,24,27) |
| InChIKey | FBXUQTFQOSMUBE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.63 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|