C25H33N3O5S — CID 133219151
4-[2,3-dihydro-1,4-benzodioxin-6-yl(methylsulfonyl)amino]-N-[3-(2-methyl-2,3-dihydroindol-1-yl)propyl]butanamide (PubChem CID 133219151) has the molecular formula C25H33N3O5S and a molecular weight of 487.62 g/mol. Its IUPAC name is 4-[2,3-dihydro-1,4-benzodioxin-6-yl(methylsulfonyl)amino]-N-[3-(2-methyl-2,3-dihydroindol-1-yl)propyl]butanamide.
| Compound Name | 4-[2,3-dihydro-1,4-benzodioxin-6-yl(methylsulfonyl)amino]-N-[3-(2-methyl-2,3-dihydroindol-1-yl)propyl]butanamide |
|---|---|
| PubChem CID | 133219151 |
| Molecular Formula | C25H33N3O5S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 4-[2,3-dihydro-1,4-benzodioxin-6-yl(methylsulfonyl)amino]-N-[3-(2-methyl-2,3-dihydroindol-1-yl)propyl]butanamide |
| SMILES | CC1Cc2ccccc2N1CCCNC(=O)CCCN(c1ccc2c(c1)OCCO2)S(C)(=O)=O |
| InChI | InChI=1S/C25H33N3O5S/c1-19-17-20-7-3-4-8-22(20)27(19)13-6-12-26-25(29)9-5-14-28(34(2,30)31)21-10-11-23-24(18-21)33-16-15-32-23/h3-4,7-8,10-11,18-19H,5-6,9,12-17H2,1-2H3,(H,26,29) |
| InChIKey | WJXUCFZVBQXEOZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|